| Product Name | 1-Bromo-2-chloro-4-nitrobenzene |
| CAS No. | 29682-39-1 |
| Synonyms | 4-Bromo-3-chloronitrobenzene |
| InChI | InChI=1/C6H3BrClNO2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H |
| Molecular Formula | C6H3BrClNO2 |
| Molecular Weight | 236.4505 |
| Density | 1.827g/cm3 |
| Boiling point | 282.2°C at 760 mmHg |
| Flash point | 124.5°C |
| Refractive index | 1.618 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
29682-39-1 1-bromo-2-chloro-4-nitrobenzene
service@apichina.com