| Product Name | 1-Bromo-2-chloro-4-fluorobenzene |
| CAS No. | 110407-59-5 |
| Synonyms | 4-Bromo-3-chlorofluorobenzene; 2-Chloro-4-Fluorobromobenzene |
| InChI | InChI=1/C6H3BrClF/c7-5-2-1-4(9)3-6(5)8/h1-3H |
| Molecular Formula | C6H3BrClF |
| Molecular Weight | 209.4434 |
| Density | 1.719g/cm3 |
| Boiling point | 196.3°C at 760 mmHg |
| Flash point | 72.5°C |
| Refractive index | 1.55 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
110407-59-5 1-bromo-2-chloro-4-fluorobenzene
service@apichina.com