| Product Name | 1-bromo-2-butanone |
| CAS No. | 816-40-0 |
| Synonyms | Bromomethyl ethyl ketone; 1-bromobutan-2-one |
| InChI | InChI=1/C4H7BrO/c1-2-4(6)3-5/h2-3H2,1H3 |
| Molecular Formula | C4H7BrO |
| Molecular Weight | 151.0018 |
| Density | 1.439g/cm3 |
| Boiling point | 155.9°C at 760 mmHg |
| Flash point | 68.3°C |
| Refractive index | 1.452 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
816-40-0 1-bromo-2-butanone
service@apichina.com