| Product Name | 1-bromo-2,5-dimethoxy-4-methylbenzene |
| CAS No. | 13321-74-9 |
| InChI | InChI=1/C9H11BrO2/c1-6-4-9(12-3)7(10)5-8(6)11-2/h4-5H,1-3H3 |
| Molecular Formula | C9H11BrO2 |
| Molecular Weight | 231.0864 |
| Density | 1.36g/cm3 |
| Melting point | 77℃ |
| Boiling point | 270.4°C at 760 mmHg |
| Flash point | 114.1°C |
| Refractive index | 1.525 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
13321-74-9 1-bromo-2,5-dimethoxy-4-methylbenzene
service@apichina.com