| Product Name | 1-Bromo-2,5-difluoro-4-nitrobenzene |
| CAS No. | 167415-27-2 |
| Synonyms | 4-Bromo-2,5-difluoronitrobenzene |
| InChI | InChI=1/C6H2BrF2NO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H |
| Molecular Formula | C6H2BrF2NO2 |
| Molecular Weight | 237.9864 |
| Density | 1.89g/cm3 |
| Boiling point | 262.4°C at 760 mmHg |
| Flash point | 112.5°C |
| Refractive index | 1.556 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
167415-27-2 1-bromo-2,5-difluoro-4-nitrobenzene
service@apichina.com