| Product Name | 1-Bromo-2,3,5-trichlorobenzene |
| CAS No. | 81067-38-1 |
| Synonyms | 2,3,5-Trichlorobromobenzene |
| InChI | InChI=1/C6H2BrCl3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
| Molecular Formula | C6H2BrCl3 |
| Molecular Weight | 260.3431 |
| Density | 1.84g/cm3 |
| Melting point | 58-61℃ |
| Boiling point | 270.8°C at 760 mmHg |
| Flash point | 129.3°C |
| Refractive index | 1.603 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
81067-38-1 1-bromo-2,3,5-trichlorobenzene
service@apichina.com