| Product Name | 1-Bromo-1-chloroethane |
| CAS No. | 593-96-4 |
| Synonyms | Ethane, 1-bromo-1-chloro- |
| InChI | InChI=1/C2H4BrCl/c1-2(3)4/h2H,1H3 |
| Molecular Formula | C2H4BrCl |
| Molecular Weight | 143.4102 |
| Density | 1.658g/cm3 |
| Boiling point | 79.5°C at 760 mmHg |
| Refractive index | 1.463 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
593-96-4 1-bromo-1-chloroethane
service@apichina.com