| Product Name | 1-biphenylenylboronic acid |
| CAS No. | 499769-97-0 |
| Synonyms | biphenylen-1-ylboronic acid |
| InChI | InChI=1/C12H9BO2/c14-13(15)11-7-3-6-10-8-4-1-2-5-9(8)12(10)11/h1-7,14-15H |
| Molecular Formula | C12H9BO2 |
| Molecular Weight | 196.0097 |
| Density | 1.31g/cm3 |
| Melting point | 250℃ |
| Boiling point | 415.4°C at 760 mmHg |
| Flash point | 205°C |
| Refractive index | 1.751 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
499769-97-0 1-biphenylenylboronic acid
service@apichina.com