| Product Name | 1-Benzylhomopiperazine |
| CAS No. | 4410-12-2 |
| Synonyms | 1-Benzylhexahydro-1,4-diazepine; N-benzylhomopiperazine; 1-benzyl-1,4-diazepane; 1-Benzyl-1,4-diazacycloheptane; 1-Benzyl-1,4-diazacycloheptanel |
| InChI | InChI=1/C12H18N2/c1-2-5-12(6-3-1)11-14-9-4-7-13-8-10-14/h1-3,5-6,13H,4,7-11H2 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.2847 |
| Density | 1.003g/cm3 |
| Boiling point | 286.5°C at 760 mmHg |
| Flash point | 116.2°C |
| Refractive index | 1.536 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
4410-12-2 1-benzylhomopiperazine
service@apichina.com