| Product Name | 1-Benzyl-4-(ethoxycarbonylmethyl)piperazine |
| CAS No. | 23173-76-4 |
| Synonyms | N-Benzyl-N-(carboethoxymethyl)piperazine; ethyl (4-benzylpiperazin-1-yl)acetate; ethyl 2-(4-benzylpiperazin-1-yl)acetate |
| InChI | InChI=1/C15H22N2O2/c1-2-19-15(18)13-17-10-8-16(9-11-17)12-14-6-4-3-5-7-14/h3-7H,2,8-13H2,1H3 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.3474 |
| Density | 1.088g/cm3 |
| Boiling point | 360.7°C at 760 mmHg |
| Flash point | 172°C |
| Refractive index | 1.535 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
23173-76-4 1-benzyl-4-(ethoxycarbonylmethyl)piperazine
service@apichina.com