| Product Name | 1-Benzyl-4-cyano-4-hydroxypiperidine hydrochloride |
| CAS No. | 71617-20-4 |
| Synonyms | 1-Benzyl-4-hydroxyisonipecotonitrile hydrochloride; N-benzyl-4-hydroxypiperidine-4-carbonitrile hydrochloride; 1-benzyl-4-hydroxypiperidine-4-carbonitrile hydrochloride |
| InChI | InChI=1/C13H16N2O.ClH/c14-11-13(16)6-8-15(9-7-13)10-12-4-2-1-3-5-12;/h1-5,16H,6-10H2;1H |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.7399 |
| Melting point | 172-177℃ |
| Boiling point | 399.5°C at 760 mmHg |
| Flash point | 195.4°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
71617-20-4 1-benzyl-4-cyano-4-hydroxypiperidine hydrochloride
service@apichina.com