| Product Name | 1-Benzyl-2-(methylsulfanyl)-1H-imidazole- 5-carboxylic acid |
| CAS No. | 403479-30-1 |
| Synonyms | 1-benzyl-2-(methylsulfanyl)-1H-imidazole-5-carboxylic acid |
| InChI | InChI=1/C12H12N2O2S/c1-17-12-13-7-10(11(15)16)14(12)8-9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,15,16) |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.3009 |
| Density | 1.28g/cm3 |
| Boiling point | 506.2°C at 760 mmHg |
| Flash point | 260°C |
| Refractive index | 1.636 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S36:Wear suitable protective clothing.; S37/39:Wear suitable gloves and eye/face protection.; |
403479-30-1 1-benzyl-2-(methylsulfanyl)-1h-imidazole- 5-carboxylic acid
service@apichina.com