| Product Name | (1-Benzyl-1H-imidazol-2-yl)methylamine |
| CAS No. | 26163-58-6 |
| Synonyms | 1-(1-benzyl-1H-imidazol-2-yl)methanamine |
| InChI | InChI=1/C11H13N3/c12-8-11-13-6-7-14(11)9-10-4-2-1-3-5-10/h1-7H,8-9,12H2 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.241 |
| Density | 1.135g/cm3 |
| Boiling point | 340.421°C at 760 mmHg |
| Flash point | 159.681°C |
| Refractive index | 1.609 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
26163-58-6 (1-benzyl-1h-imidazol-2-yl)methylamine
service@apichina.com