| Product Name | 1-Benzyl-1,2,3-triazole-4,5-dicarboxylic Acid |
| CAS No. | 73953-89-6 |
| Synonyms | v-Triazole-4,5-dicarboxylic acid, 1-benzyl-; 1-Benzyl-1,2,3-triazole-4,5-dicarboxylic acid; 1H-1,2,3-Triazole-4,5-dicarboxylic acid, 1-(phenylmethyl)-; 4-26-00-00965 (Beilstein Handbook Reference); BRN 0029417; 1-benzyl-1H-1,2,3-triazole-4,5-dicarboxylic acid; 1-benzyl-1H-1,2,3-triazole-4,5-dicarboxylate |
| InChI | InChI=1/C11H9N3O4/c15-10(16)8-9(11(17)18)14(13-12-8)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,15,16)(H,17,18)/p-2 |
| Molecular Formula | C11H7N3O4 |
| Molecular Weight | 245.1921 |
| Boiling point | 558.5°C at 760 mmHg |
| Flash point | 291.6°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
73953-89-6 1-benzyl-1,2,3-triazole-4,5-dicarboxylic acid
service@apichina.com