| Product Name | 1-Benzothiophene-5-carbonyl chloride |
| CAS No. | 1128-89-8 |
| InChI | InChI=1/C9H5ClOS/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H |
| Molecular Formula | C9H5ClOS |
| Molecular Weight | 196.6534 |
| Density | 1.41g/cm3 |
| Melting point | 88℃ |
| Boiling point | 309.5°C at 760 mmHg |
| Flash point | 141°C |
| Refractive index | 1.68 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1128-89-8 1-benzothiophene-5-carbonyl chloride
service@apichina.com