| Product Name | 1-benzothiophene-3-carbothioamide |
| CAS No. | 24662-24-6 |
| InChI | InChI=1/C9H7NS2/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5H,(H2,10,11) |
| Molecular Formula | C9H7NS2 |
| Molecular Weight | 193.2886 |
| Density | 1.384g/cm3 |
| Melting point | 109℃ |
| Boiling point | 364.8°C at 760 mmHg |
| Flash point | 174.4°C |
| Refractive index | 1.781 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
24662-24-6 1-benzothiophene-3-carbothioamide
service@apichina.com