| Product Name | 1-benzothiophen-3-ylmethylamine hydrochloride |
| CAS No. | 55810-74-7 |
| Synonyms | Benzo[b]thiophen-3-ylmethylamine hydrochloride; 1-(1-benzothiophen-3-yl)methanamine hydrochloride |
| InChI | InChI=1/C9H9NS.ClH/c10-5-7-6-11-9-4-2-1-3-8(7)9;/h1-4,6H,5,10H2;1H |
| Molecular Formula | C9H10ClNS |
| Molecular Weight | 199.7004 |
| Melting point | 241℃ |
| Boiling point | 303.9°C at 760 mmHg |
| Flash point | 137.6°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
55810-74-7 1-benzothiophen-3-ylmethylamine hydrochloride
service@apichina.com