| Product Name | 1-Benzofuran-5-ylmethylamine |
| CAS No. | 37798-08-6 |
| Synonyms | 1-(1-benzofuran-5-yl)methanamine |
| InChI | InChI=1/C9H9NO/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5H,6,10H2 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.1739 |
| Density | 1.164g/cm3 |
| Boiling point | 254.3°C at 760 mmHg |
| Flash point | 107.6°C |
| Refractive index | 1.628 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
37798-08-6 1-benzofuran-5-ylmethylamine
service@apichina.com