| Product Name | 1-Benzofuran-5-yl isocyanate |
| CAS No. | 499770-79-5 |
| Synonyms | 5-isocyanato-1-benzofuran |
| InChI | InChI=1/C9H5NO2/c11-6-10-8-1-2-9-7(5-8)3-4-12-9/h1-5H |
| Molecular Formula | C9H5NO2 |
| Molecular Weight | 159.1415 |
| Density | 1.23g/cm3 |
| Melting point | 36.4℃ |
| Boiling point | 231.2°C at 760 mmHg |
| Flash point | 93.6°C |
| Refractive index | 1.602 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
499770-79-5 1-benzofuran-5-yl isocyanate
service@apichina.com