| Product Name | 1-benzofuran-5-carboxylic acid |
| CAS No. | 90721-27-0 |
| InChI | InChI=1/C9H6O3/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H,(H,10,11) |
| Molecular Formula | C9H6O3 |
| Molecular Weight | 162.1421 |
| Density | 1.363g/cm3 |
| Melting point | 188℃ |
| Boiling point | 325.6°C at 760 mmHg |
| Flash point | 150.7°C |
| Refractive index | 1.649 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
90721-27-0 1-benzofuran-5-carboxylic acid
service@apichina.com