| Product Name | 1-aminothioxanthen-9-one |
| CAS No. | 40021-31-6 |
| Synonyms | 1-Aminothioxanthen-9-one; 1-amino-9H-thioxanthen-9-one |
| InChI | InChI=1/C13H9NOS/c14-9-5-3-7-11-12(9)13(15)8-4-1-2-6-10(8)16-11/h1-7H,14H2 |
| Molecular Formula | C13H9NOS |
| Molecular Weight | 227.2817 |
| Density | 1.383g/cm3 |
| Boiling point | 439.7°C at 760 mmHg |
| Flash point | 219.7°C |
| Refractive index | 1.74 |
40021-31-6 1-aminothioxanthen-9-one
service@apichina.com