| Product Name | 1-Adamantyl isothiocyanate |
| CAS No. | 4411-26-1 |
| Synonyms | tricyclo(3.3.1.13,7)dec-1-yl isocyanate; Isothiocyanic acid 1-adamantyl estr; 1-isothiocyanatotricyclo[3.3.1.1~3,7~]decane |
| InChI | InChI=1/C11H15NS/c13-7-12-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-6H2 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.3085 |
| Density | 1.35g/cm3 |
| Melting point | 166-168℃ |
| Boiling point | 297.6°C at 760 mmHg |
| Flash point | 138°C |
| Refractive index | 1.721 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4411-26-1 1-adamantyl isothiocyanate
service@apichina.com