| Product Name | 1-Acetylpiperidine-4-carbonyl chloride |
| CAS No. | 59084-16-1 |
| Synonyms | N-Acetylisonipecotoyl chloride; 1-Acetylisonipecotoyl Chloride |
| InChI | InChI=1/C8H12ClNO2/c1-6(11)10-4-2-7(3-5-10)8(9)12/h7H,2-5H2,1H3 |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 189.6394 |
| Density | 1.224g/cm3 |
| Boiling point | 308°C at 760 mmHg |
| Flash point | 140.1°C |
| Refractive index | 1.496 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
59084-16-1 1-acetylpiperidine-4-carbonyl chloride
service@apichina.com