| Product Name | 1-acetyl-4-methyl-2,5-dihydro-1H-pyrrol-2-one |
| CAS No. | 34581-92-5 |
| Synonyms | 1-acetyl-4-methyl-1,5-dihydro-2H-pyrrol-2-one |
| InChI | InChI=1/C7H9NO2/c1-5-3-7(10)8(4-5)6(2)9/h3H,4H2,1-2H3 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.1519 |
| Density | 1.171g/cm3 |
| Melting point | 89℃ |
| Boiling point | 265.4°C at 760 mmHg |
| Flash point | 121.4°C |
| Refractive index | 1.512 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
34581-92-5 1-acetyl-4-methyl-2,5-dihydro-1h-pyrrol-2-one
service@apichina.com