| Product Name | 1,8-Diazabicyclo[5.4.0]undec-7-ene hydrotribromide |
| CAS No. | 138666-59-8 |
| Synonyms | DBUHBr_3; 1,8-Diazabicyclo[5.4.0]undec-7-ene hydrobromide perbromide |
| InChI | InChI=1/C9H16N2.Br3/c1-2-5-9-10-6-4-8-11(9)7-3-1;1-3-2/h1-8H2;/q;-1/p+1 |
| Molecular Formula | C9H17Br3N2 |
| Molecular Weight | 392.95668 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
138666-59-8 1,8-diazabicyclo[5.4.0]undec-7-ene hydrotribromide
service@apichina.com