| Product Name | 1-(8-bromo-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethan-1-one |
| CAS No. | 175136-35-3 |
| Synonyms | 7-acetyl-8-bromo-3,4-dihydro-2h-1,5-benzodioxepine; 1-(7-bromo-2,3-dihydro-1,4-benzodioxin-6-yl)ethanone; 1-(8-bromo-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethanone |
| InChI | InChI=1/C11H11BrO3/c1-7(13)8-5-10-11(6-9(8)12)15-4-2-3-14-10/h5-6H,2-4H2,1H3 |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.1072 |
| Density | 1.475g/cm3 |
| Melting point | 56℃ |
| Boiling point | 379.4°C at 760 mmHg |
| Flash point | 183.2°C |
| Refractive index | 1.559 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175136-35-3 1-(8-bromo-3,4-dihydro-2h-1,5-benzodioxepin-7-yl)ethan-1-one
service@apichina.com