| Product Name | 1,6-Dibromo-2-hydroxynaphthalene-3-carboxylic acid |
| CAS No. | 1779-10-8 |
| Synonyms | 1,6-Dibromo-2-naphthol-3-carboxylic acid; 4,7-dibromo-3-hydroxynaphthalene-2-carboxylic acid; 4,7-dibromo-3-hydroxynaphthalene-2-carboxylate |
| InChI | InChI=1/C11H6Br2O3/c12-6-1-2-7-5(3-6)4-8(11(15)16)10(14)9(7)13/h1-4,14H,(H,15,16)/p-1 |
| Molecular Formula | C11H5Br2O3 |
| Molecular Weight | 344.9641 |
| Melting point | 251-253℃ |
| Boiling point | 427.6°C at 760 mmHg |
| Flash point | 212.4°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1779-10-8 1,6-dibromo-2-hydroxynaphthalene-3-carboxylic acid
service@apichina.com