| Product Name | 1-(6-chloro-1,3-benzothiazol-2-yl)hydrazine |
| CAS No. | 51011-54-2 |
| Synonyms | (6-Chloro-benzothiazol-2-yl)-hydrazine; 6-chloro-2-hydrazinyl-1,3-benzothiazole; (6-chlorobenzothiazol-2-yl)hydrazine; 6-chloro-2-hydrazino-benzothiazole; 1,2-Hydrazino-6-chlorobenzothiazole; F1908-0017; (6-chloro-1,3-benzothiazol-2-yl)hydrazine |
| InChI | InChI=1/C7H6ClN3S/c8-4-1-2-5-6(3-4)12-7(10-5)11-9/h1-3H,9H2,(H,10,11) |
| Molecular Formula | C7H6ClN3S |
| Molecular Weight | 199.6606 |
| Density | 1.599g/cm3 |
| Melting point | 212℃ |
| Boiling point | 361.293°C at 760 mmHg |
| Flash point | 172.304°C |
| Refractive index | 1.813 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
51011-54-2 1-(6-chloro-1,3-benzothiazol-2-yl)hydrazine
service@apichina.com