| Product Name | 1,5-Dimethylnaphthalene |
| CAS No. | 571-61-9 |
| Synonyms | NSC 59388; Naphthalene, 1,5-dimethyl-; Naphthalene, 1,5-dimethyl- (8CI)(9CI); N-methyl-N-nitrosomethanamine |
| InChI | InChI=1/C12H12/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h3-8H,1-2H3 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.2237 |
| Density | 1g/cm3 |
| Melting point | 78-266℃ |
| Boiling point | 265.6°C at 760 mmHg |
| Flash point | 111.4°C |
| Refractive index | 1.604 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
571-61-9 1,5-dimethylnaphthalene
service@apichina.com