| Product Name | 1,5-Dimethyl-2-pyrrolecarbonitrile |
| CAS No. | 56341-36-7 |
| Synonyms | 1,5-Dimethylpyrrole-2-carbonitrile; 1,5-dimethyl-1H-pyrrole-2-carbonitrile; 1,2-Dimethyl-5-cyanopyrrole |
| InChI | InChI=1/C7H8N2/c1-6-3-4-7(5-8)9(6)2/h3-4H,1-2H3 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.1518 |
| Density | 0.98g/cm3 |
| Melting point | 53-56℃ |
| Boiling point | 238.9°C at 760 mmHg |
| Flash point | 104.4°C |
| Refractive index | 1.529 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21:Harmful by inhalation and in contact with skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; |
56341-36-7 1,5-dimethyl-2-pyrrolecarbonitrile
service@apichina.com