| Product Name | (1,5-dimethyl-1H-pyrazol-3-yl)methanol |
| CAS No. | 153912-60-8 |
| InChI | InChI=1/C6H10N2O/c1-5-3-6(4-9)7-8(5)2/h3,9H,4H2,1-2H3 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.1564 |
| Density | 1.13g/cm3 |
| Boiling point | 248.6°C at 760 mmHg |
| Flash point | 104.1°C |
| Refractive index | 1.543 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
153912-60-8 (1,5-dimethyl-1h-pyrazol-3-yl)methanol
service@apichina.com