| Product Name | 1,5-dimethyl-1H,5H-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithiol |
| CAS No. | 16085-50-0 |
| Synonyms | Tetrahydro-3,7-dimethyl-1H,5H-(1,2,4)-triazole-(1,2-a)(1,2,4)-triazole 1,5 dithione; 3,7-dimethyltetrahydro-1H,5H-[1,2,4]triazolo[1,2-a][1,2,4]triazole-1,5-dithione |
| InChI | InChI=1/C6H10N4S2/c1-3-7-5(11)10-4(2)8-6(12)9(3)10/h3-4H,1-2H3,(H,7,11)(H,8,12) |
| Molecular Formula | C6H10N4S2 |
| Molecular Weight | 202.3004 |
| Density | 1.54g/cm3 |
| Melting point | 182℃ |
| Boiling point | 245.4°C at 760 mmHg |
| Flash point | 102.2°C |
| Refractive index | 1.778 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
16085-50-0 1,5-dimethyl-1h,5h-[1,2,4]triazolo[1,2-a][1,2,4]triazole-3,7-dithiol
service@apichina.com