| Product Name | 1,5-dihydroxyanthraquinone |
| CAS No. | 117-12-4 |
| Synonyms | Anthrarufin,80%; 9,10-Anthracenedione, 1,5-dihydroxy-; ANTHRARUFIN; 1,5-dihydroxyanthracene-9,10-dione |
| InChI | InChI=1/C14H8O4/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6,15-16H |
| Molecular Formula | C14H8O4 |
| Molecular Weight | 240.2109 |
| Density | 1.54g/cm3 |
| Melting point | 268-273℃ |
| Boiling point | 452.7°C at 760 mmHg |
| Flash point | 241.7°C |
| Refractive index | 1.732 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
117-12-4 1,5-dihydroxyanthraquinone
service@apichina.com