| Product Name | 1-(4-Nitrophenyl)piperidine |
| CAS No. | 6574-15-8 |
| Synonyms | AI3-02748; Piperidine, 1-(4-nitrophenyl)-; 6-amino-1,3-dimethyl-5-({[3-(4-methylphenyl)-4-oxo-3,4-dihydroquinazolin-2-yl]sulfanyl}acetyl)pyrimidine-2,4(1H,3H)-dione |
| InChI | InChI=1/C23H21N5O4S/c1-13-8-10-14(11-9-13)28-20(30)15-6-4-5-7-16(15)25-22(28)33-12-17(29)18-19(24)26(2)23(32)27(3)21(18)31/h4-11H,12,24H2,1-3H3 |
| Molecular Formula | C23H21N5O4S |
| Molecular Weight | 463.5089 |
| Density | 1.43g/cm3 |
| Melting point | 104℃ |
| Boiling point | 649.2°C at 760 mmHg |
| Flash point | 346.5°C |
| Refractive index | 1.706 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
6574-15-8 1-(4-nitrophenyl)piperidine
service@apichina.com