| Sales Email | Service@apichina.com |
| CAS No. | 22711-24-6 |
| Product Name | 1-(4-nitrophenyl)-2-phenylethane-1,2-dione |
| InChI | InChI=1/C14H9NO4/c16-13(10-4-2-1-3-5-10)14(17)11-6-8-12(9-7-11)15(18)19/h1-9H |
| Molecular Formula | C14H9NO4 |
| Molecular Weight | 255.2256 |
| Density | 1.327g/cm3 |
| Melting point | 130℃ |
| Boiling point | 444.9°C at 760 mmHg |
| Flash point | 220.9°C |
| Refractive index | 1.623 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
