| Product Name | 1-(4-Methylphenyl)-1-cyclopentanecarbonitrile |
| CAS No. | 68983-70-0 |
| Synonyms | 1-(p-Tolyl)-1-cyclopentanecarbonitrile; 1-(4-methylphenyl)cyclopentanecarbonitrile |
| InChI | InChI=1/C13H15N/c1-11-4-6-12(7-5-11)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.2649 |
| Density | 1.02g/cm3 |
| Boiling point | 326.2°C at 760 mmHg |
| Flash point | 121.3°C |
| Refractive index | 1.546 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
68983-70-0 1-(4-methylphenyl)-1-cyclopentanecarbonitrile
service@apichina.com