| Product Name | 1-(4-methoxyphenyl)-2-thiourea |
| CAS No. | 2293-07-4 |
| Synonyms | 4-Methoxyphenylthiourea; 1-(4-methoxyphenyl)thiourea |
| InChI | InChI=1/C8H10N2OS/c1-11-7-4-2-6(3-5-7)10-8(9)12/h2-5H,1H3,(H3,9,10,12) |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.2428 |
| Density | 1.287g/cm3 |
| Melting point | 212℃ |
| Boiling point | 311°C at 760 mmHg |
| Flash point | 141.9°C |
| Refractive index | 1.677 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S38:In case of insufficient ventilation, wear suitable respiratory equipment.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
2293-07-4 1-(4-methoxyphenyl)-2-thiourea
service@apichina.com