| Product Name | 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile |
| CAS No. | 1206-15-1 |
| Synonyms | 1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
| InChI | InChI=1/C13H15NO/c1-15-12-6-4-11(5-7-12)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.2643 |
| Density | 1.07g/cm3 |
| Boiling point | 346.4°C at 760 mmHg |
| Flash point | 146.2°C |
| Refractive index | 1.543 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1206-15-1 1-(4-methoxyphenyl)-1-cyclopentanecarbonitrile
service@apichina.com