| Product Name | 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile |
| CAS No. | 36263-51-1 |
| Synonyms | 1-(4-Methoxyphenyl)cyclohexanecarbonitrile |
| InChI | InChI=1/C14H17NO/c1-16-13-7-5-12(6-8-13)14(11-15)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.2909 |
| Density | 1.06g/cm3 |
| Melting point | 40-45℃ |
| Boiling point | 362°C at 760 mmHg |
| Flash point | 152.6°C |
| Refractive index | 1.538 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
36263-51-1 1-(4-methoxyphenyl)-1-cyclohexanecarbonitrile
service@apichina.com