| Product Name | 1-(4-fluorophenyl)-2-thiourea |
| CAS No. | 459-05-2 |
| Synonyms | 4-Fluorophenylthiourea; 1-(4-fluorophenyl)thiourea |
| InChI | InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| Molecular Formula | C7H7FN2S |
| Molecular Weight | 170.2073 |
| Density | 1.397g/cm3 |
| Melting point | 164℃ |
| Boiling point | 264.2°C at 760 mmHg |
| Flash point | 113.6°C |
| Refractive index | 1.692 |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
459-05-2 1-(4-fluorophenyl)-2-thiourea
service@apichina.com