| Product Name | 1,4-Diphenylbutadiyne |
| CAS No. | 886-66-8 |
| InChI | InChI=1/C16H10/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-6,9-12H |
| Molecular Formula | C16H10 |
| Molecular Weight | 202.2506 |
| Density | 1.1g/cm3 |
| Melting point | 85-88℃ |
| Boiling point | 338.2°C at 760 mmHg |
| Flash point | 150.5°C |
| Refractive index | 1.642 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
886-66-8 1,4-diphenylbutadiyne
service@apichina.com