| Product Name | 1,4-dimethylpiperazine-2-carbohydrazide |
| CAS No. | 175203-52-8 |
| InChI | InChI=1/C7H16N4O/c1-10-3-4-11(2)6(5-10)7(12)9-8/h6H,3-5,8H2,1-2H3,(H,9,12) |
| Molecular Formula | C7H16N4O |
| Molecular Weight | 172.2281 |
| Density | 1.105g/cm3 |
| Melting point | 105℃ |
| Boiling point | 339.7°C at 760 mmHg |
| Flash point | 159.2°C |
| Refractive index | 1.511 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
175203-52-8 1,4-dimethylpiperazine-2-carbohydrazide
service@apichina.com