| Product Name | 1,4-difluoro-2,5-dimethoxybenzene |
| CAS No. | 199866-90-5 |
| InChI | InChI=1/C8H8F2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
| Molecular Formula | C8H8F2O2 |
| Molecular Weight | 174.1447 |
| Density | 1.193g/cm3 |
| Boiling point | 193.7°C at 760 mmHg |
| Flash point | 77.4°C |
| Refractive index | 1.455 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
199866-90-5 1,4-difluoro-2,5-dimethoxybenzene
service@apichina.com