| Product Name | 1,4-Dichloro-5,6,7,8-tetrahydro-5,8-ethanophthalazine |
| CAS No. | 202823-67-4 |
| InChI | InChI=1/C10H10Cl2N2/c11-9-7-5-1-2-6(4-3-5)8(7)10(12)14-13-9/h5-6H,1-4H2 |
| Molecular Formula | C10H10Cl2N2 |
| Molecular Weight | 229.1058 |
| Density | 1.404g/cm3 |
| Boiling point | 343.7°C at 760 mmHg |
| Flash point | 192.3°C |
| Refractive index | 1.606 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
202823-67-4 1,4-dichloro-5,6,7,8-tetrahydro-5,8-ethanophthalazine
service@apichina.com