| Product Name | 1,4-Dichloro-2-iodobenzene |
| CAS No. | 29682-41-5 |
| Synonyms | 2,5-Dichloroiodobenzene; ethyl 2-(methylsulfanyl)quinoline-1(2H)-carboxylate |
| InChI | InChI=1/C6H3Cl2I/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| Molecular Formula | C6H3Cl2I |
| Molecular Weight | 272.8985 |
| Density | 2.015g/cm3 |
| Melting point | 21-257℃ |
| Boiling point | 255.5°C at 760 mmHg |
| Flash point | 93.9°C |
| Refractive index | 1.642 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
29682-41-5 1,4-dichloro-2-iodobenzene
service@apichina.com