| Product Name | 1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle |
| CAS No. | 69225-59-8 |
| Synonyms | 1,4-Cyclohexanedione mono-2,2-dimethyltrimethylene ketal; 3,3-dimethyl-1,5-dioxaspiro(5.5)undecan-9-one; 3,3-Dimethyl-1,5-dioxaspiro[5.5]undecan-8-one; 3,3-Dimethyl-1,5-dioxaspiro[5.5]undecan-9-one; 1,4-Cyclohexanedione Mono(2,2-Dimethyltrimethylene Ketal) |
| InChI | InChI=1/C11H18O3/c1-10(2)7-13-11(14-8-10)5-3-9(12)4-6-11/h3-8H2,1-2H3 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.2588 |
| Density | 1.08g/cm3 |
| Melting point | 45-50℃ |
| Boiling point | 295.4°C at 760 mmHg |
| Flash point | 123.3°C |
| Refractive index | 1.484 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
69225-59-8 1,4-cyclohexanedione mono-2,2-dimethyl-trimethyle
service@apichina.com