| Product Name | 1,4-Cyclohexanediol, mixture of cis and trans |
| CAS No. | 556-48-9 |
| Synonyms | Cyclohexanediolcistrans; 1,4-Cyclohexanediol; Hexahydrohydroquinone; 1,4-Hexandiol; Quinitol; 1,4-Bis(hydroxymethyl)-cyclohexane; cyclohexane-1,4-diol; trans-cyclohexane-1,4-diol; 1,4-Cyclohexanediol (cis & trans mixture) |
| InChI | InChI=1/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2/t5-,6- |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.1583 |
| Density | 1.156g/cm3 |
| Melting point | 98-100℃ |
| Boiling point | 252.4°C at 760 mmHg |
| Flash point | 65.6°C |
| Refractive index | 1.526 |
| Safety | S24/25:; |
556-48-9 1,4-cyclohexanediol, mixture of cis and trans
service@apichina.com