| Product Name | 1,4-Cyclohexanedimethanol, mixture of cisand trans |
| CAS No. | 105-08-8 |
| Synonyms | 1,4-Bis(hydroxymethyl)cyclohexane; cyclohex-1,4-ylenedimethanol; 1,4-Cyclohexane dimethanol; cyclohexane-1,4-diyldimethanol; 1,4-Cyclohexanedimethanol; CHDM |
| InChI | InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.2114 |
| Density | 1.004g/cm3 |
| Melting point | 31.5℃ |
| Boiling point | 286.2°C at 760 mmHg |
| Flash point | 161.1°C |
| Water solubility | miscible |
| Refractive index | 1.47 |
| Risk Codes | R36:; |
| Safety | S26:; S39:; |
105-08-8 1,4-cyclohexanedimethanol, mixture of cisand trans
service@apichina.com