| Product Name | 1-(4-Chlorophenyl)-biguanide hydrochloride |
| CAS No. | 4022-81-5 |
| Synonyms | 1-(4-Chlorophenyl)biguanide hydrochloride; N-(4-chlorophenyl)imidodicarbonimidic diamide; 2-(4-chlorophenyl)-1-(diaminomethylidene)guanidine hydrochloride (1:1); N-{(1E)-amino[(diaminomethylidene)ammonio]methylidene}-4-chloroanilinium |
| InChI | InChI=1/C8H10ClN5/c9-5-1-3-6(4-2-5)13-8(12)14-7(10)11/h1-4H,(H6,10,11,12,13,14)/p+2 |
| Molecular Formula | C8H12ClN5 |
| Molecular Weight | 213.6663 |
| Boiling point | 426.4°C at 760 mmHg |
| Flash point | 211.7°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4022-81-5 1-(4-chlorophenyl)-biguanide hydrochloride
service@apichina.com