| Product Name | 1-(4-Chloromethylphenyl)-2-phenylethane |
| CAS No. | 80676-35-3 |
| Synonyms | 1-(Chloromethyl)-4-(2-phenylethyl)benzene; 4-Chloromethylbibenzyl; 4-Chloromethyldibenzyl |
| InChI | InChI=1/C15H15Cl/c16-12-15-10-8-14(9-11-15)7-6-13-4-2-1-3-5-13/h1-5,8-11H,6-7,12H2 |
| Molecular Formula | C15H15Cl |
| Molecular Weight | 230.7326 |
| Density | 1.095g/cm3 |
| Melting point | 39-43℃ |
| Boiling point | 324.1°C at 760 mmHg |
| Flash point | 144.1°C |
| Refractive index | 1.579 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
80676-35-3 1-(4-chloromethylphenyl)-2-phenylethane
service@apichina.com